الفرق بين المراجعتين لصفحة: «فيتامين ب5»

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
لا ملخص تعديل
لا ملخص تعديل
سطر 1: سطر 1:
{{chembox
| English = Pantothenic acid
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477003091
| ImageFile = Pantothenic acid structure.svg
| ImageSize = 220
| ImageFile1 = Pantothenic-acid-3D-balls.png
| ImageSize1 = 220
| ImageAlt1 = Pantothenic acid molecule
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageName = Structure of Pantothenic acid.png
| PIN = 3-[(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid
| SystematicName = 3-(2,4-Dihydroxy-3,3-dimethylbutanamido)propanoic acid<ref>{{cite web|title=pantothenic acid (CHEBI:7916)|url=https://www.ebi.ac.uk/chebi/searchId.do?chebiId=7916|work=Chemical Entities of Biological Interest|publisher=European Bioinformatics Institute|accessdate=3 July 2012|location=UK|date=16 November 2011|at=Main}}</ref>
| Section1 = {{chembox Identifiers
|  CASNo = 599-54-2
|  CASNo_Ref = {{cascite|changed|??}}
|  CASNo1 = 79-83-4
|  CASNo1_Ref = {{cascite|correct|CAS}}
|  CASNo1_Comment = <small>''R''</small>
|  PubChem = 988
|  PubChem_Ref = {{pubchemcite|correct|pubchem}}
|  PubChem1 = 6613
|  PubChem1_Ref = {{pubchemcite|correct|pubchem}}
|  PubChem1_Comment = <small>''R''</small>
|  PubChem2 = 5748353
|  PubChem2_Ref = {{pubchemcite|correct|pubchem}}
|  PubChem2_Comment = <small>''S''</small>
|  ChemSpiderID = 963
|  ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
|  ChemSpiderID1 = 6361
|  ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
|  ChemSpiderID1_Comment = <small>''R''</small>
|  ChemSpiderID2 = 4677898
|  ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
|  ChemSpiderID2_Comment = <small>''S''</small>
|  UNII = 568ET80C3D
|  UNII_Ref = {{fdacite|correct|FDA}}
|  EINECS = 209-965-4
|  DrugBank = DB01783
|  DrugBank_Ref = {{drugbankcite|correct|drugbank}}
|  KEGG = D07413
|  KEGG_Ref = {{keggcite|correct|kegg}}
|  MeSHName = Pantothenic+Acid
|  ChEBI = 7916
|  ChEBI_Ref = {{ebicite|changed|EBI}}
|  ChEMBL = 1594
|  ChEMBL_Ref = {{ebicite|correct|EBI}}
|  Beilstein = 1727062, 1727064 <small>''R''</small>
|  3DMet = B00193
|  SMILES = CC(C)(CO)C(O)c(:[o]):[nH]CCc(:[o]):[oH]
|  SMILES1 = CC(C)(CO)C(O)C(=O)NCCC(O)=O
|  StdInChI = 1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)
|  StdInChI_Ref = {{stdinchicite|changed|chemspider}}
|  StdInChIKey = GHOKWGTUZJEAQD-UHFFFAOYSA-N
|  StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
}}
| Section2 = {{chembox Properties
|  C = 9
|  H = 17
|  N = 1
|  O = 5
|  Density = 1.266 g mL<sup>−1</sup>
|  MeltingPtC = 183.83
|  BoilingPtC = 551.5
|  LogP = −0.856
|  pKa = 4.299
|  pKb = 9.698
}}
| Section3 = {{chembox Related
|  Function = alkanoic acids
|  OtherFunctn = {{unbulleted list|[[Arginine]]|[[Theanine]]|[[Hopantenic acid]]|[[4-(γ-Glutamylamino)butanoic acid]]}}
|  OtherCpds = [[Panthenol]]
}}
}}
حمض بانتوثينيك ([[Pantothenic acid]]) هو اسم [[فيتامين ب5]] المكون من اتحاد حمض بانتويك مع بيتا الانين.
حمض بانتوثينيك ([[Pantothenic acid]]) هو اسم [[فيتامين ب5]] المكون من اتحاد حمض بانتويك مع بيتا الانين.
 
==المصدر==
[[ملف:Pantothenic-acid.png‏|250px|thumb|Pantothenic-acid]]
 
==المصدر ==


يزجد في جميع الأغذيو خاصة في صفار البيض وكبد الحيوانات وخميرة الجعة .
يزجد في جميع الأغذيو خاصة في صفار البيض وكبد الحيوانات وخميرة الجعة .
سطر 34: سطر 106:
4-7 ملغ يومياً تزداد عند المرضعات لتصبح 10 ملغ .
4-7 ملغ يومياً تزداد عند المرضعات لتصبح 10 ملغ .


==المراجع==
==المصادر==
 
منشورات [[جامعة دمشق]]، كتاب الفيزيولوجيا، د.أمل ركاج.
*منشورات [[جامعة دمشق]]، كتاب الفيزيولوجيا، د.أمل ركاج.
 
{{بذرة}}


{{ثبت المراجع}}
{{فيتامينات}}
{{مكملات غذائية}}
[[تصنيف:أدوية]]
[[تصنيف:موسوعة الأدوية]]
[[تصنيف:فيتامينات]]
[[تصنيف:فيتامينات]]
[[تصنيف:صيدلة]]
[[تصنيف:مكملات غذائية]]

مراجعة 10:22، 7 سبتمبر 2013

فيتامين ب5
{{{Alt}}}
{{{Alt}}}
Preferred IUPAC name

3-[(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid

Systematic name

3-(2,4-Dihydroxy-3,3-dimethylbutanamido)propanoic acid[1]

المعرفات
رقم CAS 599-54-2
بوبكيم (PubChem) 988
ChemSpider 963 N, 6361 R YesY, 4677898 S YesY
UNII 568ET80C3D YesY
EC number 209-965-4
DrugBank DB01783
KEGG D07413
MeSH Pantothenic+Acid
ChEBI CHEBI:7916
ChEMBL CHEMBL1594 YesY
Beilstein Reference 1727062, 1727064 R
3DMet B00193
Jmol-3D images Image 1
Image 2
الخصائص
الصيغة الجزيئية C9H17NO5
كتلة مولية 219.21 g mol-1
الكثافة 1.266 g mL−1
نقطة الانصهار

183.83 °C, 457 K, 363 °F

نقطة الغليان

551.5 °C, 825 K, 1025 °F

log P −0.856
الحموضة (pKa) 4.299
Basicity (pKb) 9.698
مركبات قريبة
Related alkanoic acids
Related compounds Panthenol
في حال عدم ورود غير ذلك فإن البيانات الواردة أعلاه معطاة بالحالة القياسية (عند 25 °س و 100 كيلوباسكال)

حمض بانتوثينيك (Pantothenic acid) هو اسم فيتامين ب5 المكون من اتحاد حمض بانتويك مع بيتا الانين.

المصدر

يزجد في جميع الأغذيو خاصة في صفار البيض وكبد الحيوانات وخميرة الجعة .

الامتصاص

يُمتص في الأمعاء الدقيقة بآلية فاعلة قابلة للإشباع ومرتبطة بالصوديوم .

دوره الفيزيولوجي

هو أحد المكونات الرئيسة للتميم الأنزيمي " أ " ، ومشتقه الرئيسي استيل التميم " أ " A CO A الذي ينشأ من ثلاثة مصادر هي :

  1. السكريات بتواسط البيروفات .
  2. الأكسدة بيتا للحموض الدسمة .
  3. تقويض بعض الحموض الأمينية .

كما يمكن لأستيل التميم " أ " أن يسلك عدة طرائق استقلابية مختلفة فهور يؤدي :

  • دوراً في حلقة كريبس .
  • في أصناع الأحماض الدسمة AG .
  • تشكل الـــ HMG CO A (Hydroxy Methyl Glutaryl COA) والذي هو نقطة انطلاق تكوين الكوليسترول والكيتونات .

أسباب العوز

نادر لوجوده في معظم الأغذية .

أعراض العوز

التهاب الجلد ،التهاب الأمعاء ،الصلع .

الحاجة اليومية

4-7 ملغ يومياً تزداد عند المرضعات لتصبح 10 ملغ .

المصادر

منشورات جامعة دمشق، كتاب الفيزيولوجيا، د.أمل ركاج.


  1. ↑ "pantothenic acid (CHEBI:7916)". Chemical Entities of Biological Interest. UK: European Bioinformatics Institute. 16 November 2011. Main. Retrieved 3 July 2012. 
مجلوبة من «http://www.arabsciencepedia.org/w/index.php?title=فيتامين_ب5&oldid=30607»