الفرق بين المراجعتين لصفحة: «كلوفيناميد»
اذهب إلى التنقل
اذهب إلى البحث
كنان الطرح (نقاش | مساهمات) لا ملخص تعديل |
كنان الطرح (نقاش | مساهمات) لا ملخص تعديل |
||
سطر 1: | سطر 1: | ||
'''كلوفيناميد | {{Drugbox | ||
| English = Clofenamide | |||
| verifiedrevid = 437148976 | |||
| IUPAC_name = 4-chlorobenzene-1,3-disulfonamide | |||
| image = Clofenamide.png | |||
| alt = Skeletal formula of clofenamide | |||
| image2 = Clofenamide-3D-spacefill.png | |||
| alt2 = Ball-and-stick model of clofenamide | |||
| width = 180 | |||
<!--Clinical data--> | |||
| tradename = | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category = | |||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | |||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| routes_of_administration = | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number = 671-95-4 | |||
| ATC_prefix = C03 | |||
| ATC_suffix = BA07 | |||
| PubChem = 69594 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 62797 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 582ILN204B | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D01822 | |||
<!--Chemical data--> | |||
| C=6 | H=7 | Cl=1 | N=2 | O=4 | S=2 | |||
| molecular_weight = 270.714 g/mol | |||
| smiles = O=S(=O)(c1cc(ccc1Cl)S(=O)(=O)N)N | |||
| InChI = 1/C6H7ClN2O4S2/c7-5-2-1-4(14(8,10)11)3-6(5)15(9,12)13/h1-3H,(H2,8,10,11)(H2,9,12,13) | |||
| InChIKey = NENBAISIHCWPKP-UHFFFAOYAB | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C6H7ClN2O4S2/c7-5-2-1-4(14(8,10)11)3-6(5)15(9,12)13/h1-3H,(H2,8,10,11)(H2,9,12,13) | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = NENBAISIHCWPKP-UHFFFAOYSA-N | |||
}} | |||
'''كلوفيناميد (Clofenamide)''' | |||
==الزمرة الدوائية== | ==الزمرة الدوائية== | ||
مدرات البول السلفوناميدية. | مدرات البول السلفوناميدية. |
المراجعة الحالية بتاريخ 19:04، 27 أبريل 2013
Systematic (IUPAC) name | |
---|---|
4-chlorobenzene-1,3-disulfonamide | |
Clinical data | |
Pregnancy cat. | ? |
Legal status | ? |
Identifiers | |
CAS number | 671-95-4 |
ATC code | C03BA07 |
PubChem | CID 69594 |
ChemSpider | 62797 |
UNII | 582ILN204B |
KEGG | D01822 |
Chemical data | |
Formula | C6H7ClN2O4S2 |
Mol. mass | 270.714 g/mol |
| |
| |
(what is this?) (verify) |
كلوفيناميد (Clofenamide)
الزمرة الدوائية
مدرات البول السلفوناميدية.
التسمية بال(IUPAC)
4-chlorobenzene-1,3-disulfonamide
الصيغة الجزيئية
C6H7ClN2O4S2
الوزن الجزيئي
270.714 g/mol
المصدر
موسوعة ويكيبيديا.