الفرق بين المراجعتين لصفحة: «إيتوزولين»

من موسوعة العلوم العربية
اذهب إلى التنقل اذهب إلى البحث
(أنشأ الصفحة ب''''إيتوزولين Etozoline''' هو مدر عروة. تصغير|يسار {{بذرة}} {{مدرات البول}} [[تصنيف:أدو...')
 
(قالب معلومات دواء)
 
سطر 1: سطر 1:
'''إيتوزولين Etozoline''' هو مدر عروة.
{{Drugbox
| English = Etozoline
| IUPAC_name = ethyl (2''Z'')-(3-methyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)ethanoate
| image = Etozolin.png
 
<!--Clinical data-->
| tradename = 
| pregnancy_category = 
| legal_status = Rx-only
| routes_of_administration = ?
 
<!--Pharmacokinetic data-->
| bioavailability = 
| metabolism = 
| elimination_half-life = 
| excretion = 
 
<!--Identifiers-->
| CAS_number = 73-09-6
| ATC_prefix = C03
| ATC_suffix = CX01
| PubChem = 5743585
| ChemSpiderID = 4675409
 
<!--Chemical data-->
| C=13 | H=20 | N=20 | O=3 | S=1
| molecular_weight = 284.37 g/mol
| smiles = O=C(OCC)\C=C1/SC(C(=O)N1C)N2CCCCC2
}}
 
'''إيتوزولين Etozoline''' هو مدر عروي loop diuretic يستعمل في أوربا وله الأسماء التجارية ('''Diulozin''', '''Elkapin''', '''Etopinil''').<ref name="isbn3-88763-075-0">{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | pages = | isbn = 3-88763-075-0 | oclc = | doi = | accessdate = }}</ref><ref name="pmid3525089">{{cite journal | author = Lant A | title = Diuretic drugs. Progress in clinical pharmacology | journal = Drugs | volume = 31 Suppl 4 | issue = | pages = 40–55 | year = 1986 | pmid = 3525089 | doi = | url = http://content.wkhealth.com/linkback/openurl?issn=0012-6667&volume=31&issue=&spage=40}}</ref>
 
== الاصطناع ==
[[Image:Ozolinone.png|450px]]
 
== المصادر ==
{{Reflist}}
* [http://en.wikipedia.org/wiki/Etozoline الإيتوزولين - wikipedia]
* [http://en.wikipedia.org/wiki/Ozolinone Ozolinone] مدر لم يسوق تجارياً وهو المستقلب الفعال للإيتوزولين


[[ملف:220px-Etozolin.png|تصغير|يسار]]
[[ملف:220px-Etozolin.png|تصغير|يسار]]

المراجعة الحالية بتاريخ 07:37، 19 أبريل 2013

إيتوزولين
Systematic (IUPAC) name
ethyl (2Z)-(3-methyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)ethanoate
Clinical data
Pregnancy cat. ?
Legal status Prescription only
Routes ?
Identifiers
CAS number 73-09-6
ATC code C03CX01
PubChem CID 5743585
ChemSpider 4675409
Chemical data
Formula C13H20N20O3S 
Mol. mass 284.37 g/mol

إيتوزولين Etozoline هو مدر عروي loop diuretic يستعمل في أوربا وله الأسماء التجارية (Diulozin, Elkapin, Etopinil).[1][2]

الاصطناع

ملف:Ozolinone.png

المصادر

  1. Swiss Pharmaceutical Society (2000). Index Nominum 2000: International Drug Directory (Book with CD-ROM). Boca Raton: Medpharm Scientific Publishers. ISBN 3-88763-075-0. 
  2. Lant A (1986). "Diuretic drugs. Progress in clinical pharmacology". Drugs. 31 Suppl 4: 40–55. PMID 3525089. 
220px-Etozolin.png