عرض مصدر فيتامين ب5

{{chembox
| English = Pantothenic acid
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477003091
| ImageFile = Pantothenic acid structure.svg
| ImageSize = 220
| ImageFile1 = Pantothenic-acid-3D-balls.png
| ImageSize1 = 220
| ImageAlt1 = Pantothenic acid molecule
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageName = Structure of Pantothenic acid.png
| PIN = 3-[(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid
| SystematicName = 3-(2,4-Dihydroxy-3,3-dimethylbutanamido)propanoic acid<ref>{{cite web|title=pantothenic acid (CHEBI:7916)|url=https://www.ebi.ac.uk/chebi/searchId.do?chebiId=7916|work=Chemical Entities of Biological Interest|publisher=European Bioinformatics Institute|accessdate=3 July 2012|location=UK|date=16 November 2011|at=Main}}</ref>
| Section1 = {{chembox Identifiers
|  CASNo = 599-54-2
|  CASNo_Ref = {{cascite|changed|??}}
|  CASNo1 = 79-83-4
|  CASNo1_Ref = {{cascite|correct|CAS}}
|  CASNo1_Comment = <small>''R''</small>
|  PubChem = 988
|  PubChem_Ref = {{pubchemcite|correct|pubchem}}
|  PubChem1 = 6613
|  PubChem1_Ref = {{pubchemcite|correct|pubchem}}
|  PubChem1_Comment = <small>''R''</small>
|  PubChem2 = 5748353
|  PubChem2_Ref = {{pubchemcite|correct|pubchem}}
|  PubChem2_Comment = <small>''S''</small>
|  ChemSpiderID = 963
|  ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
|  ChemSpiderID1 = 6361
|  ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
|  ChemSpiderID1_Comment = <small>''R''</small>
|  ChemSpiderID2 = 4677898
|  ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
|  ChemSpiderID2_Comment = <small>''S''</small>
|  UNII = 568ET80C3D
|  UNII_Ref = {{fdacite|correct|FDA}}
|  EINECS = 209-965-4
|  DrugBank = DB01783
|  DrugBank_Ref = {{drugbankcite|correct|drugbank}}
|  KEGG = D07413
|  KEGG_Ref = {{keggcite|correct|kegg}}
|  MeSHName = Pantothenic+Acid
|  ChEBI = 7916
|  ChEBI_Ref = {{ebicite|changed|EBI}}
|  ChEMBL = 1594
|  ChEMBL_Ref = {{ebicite|correct|EBI}}
|  Beilstein = 1727062, 1727064 <small>''R''</small>
|  3DMet = B00193
|  SMILES = CC(C)(CO)C(O)c(:[o]):[nH]CCc(:[o]):[oH]
|  SMILES1 = CC(C)(CO)C(O)C(=O)NCCC(O)=O
|  StdInChI = 1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)
|  StdInChI_Ref = {{stdinchicite|changed|chemspider}}
|  StdInChIKey = GHOKWGTUZJEAQD-UHFFFAOYSA-N
|  StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
}}
| Section2 = {{chembox Properties
|  C = 9
|  H = 17
|  N = 1
|  O = 5
|  Density = 1.266 g mL<sup>−1</sup>
|  MeltingPtC = 183.83
|  BoilingPtC = 551.5
|  LogP = −0.856
|  pKa = 4.299
|  pKb = 9.698
}}
| Section3 = {{chembox Related
|  Function = alkanoic acids
|  OtherFunctn = {{unbulleted list|[[Arginine]]|[[Theanine]]|[[Hopantenic acid]]|[[4-(γ-Glutamylamino)butanoic acid]]}}
|  OtherCpds = [[Panthenol]]
}}
}}
حمض بانتوثينيك ([[Pantothenic acid]]) هو اسم [[فيتامين ب5]] المكون من اتحاد حمض بانتويك مع بيتا الانين.
==المصدر==

يزجد في جميع الأغذيو خاصة في صفار البيض وكبد الحيوانات وخميرة الجعة .

==الامتصاص ==

يُمتص في الأمعاء الدقيقة بآلية فاعلة قابلة للإشباع ومرتبطة بالصوديوم .

==دوره الفيزيولوجي ==

هو أحد المكونات الرئيسة للتميم الأنزيمي " أ " ، ومشتقه الرئيسي استيل التميم " أ " A CO A الذي ينشأ من ثلاثة مصادر هي :
*السكريات بتواسط البيروفات .
*الأكسدة بيتا للحموض الدسمة .
*تقويض بعض الحموض الأمينية .
كما يمكن لأستيل التميم " أ " أن يسلك عدة طرائق استقلابية مختلفة فهور يؤدي :
*دوراً في حلقة كريبس .
*في أصناع الأحماض الدسمة AG .
*تشكل الـــ HMG  CO A  (Hydroxy Methyl Glutaryl COA) والذي هو نقطة انطلاق تكوين الكوليسترول والكيتونات .

==أسباب العوز ==

نادر لوجوده في معظم الأغذية .

==أعراض العوز ==

التهاب الجلد ،التهاب الأمعاء ،الصلع .

==الحاجة اليومية ==

4-7 ملغ يومياً تزداد عند المرضعات لتصبح 10 ملغ .

==المصادر==
منشورات [[جامعة دمشق]]، كتاب الفيزيولوجيا، د.أمل ركاج.

== انظر أيضاً ==
* [[فيتامين]]
* [[فيتامين B1]]
* [[فيتامين B2]]
* [[فيتامين B6]]
* [[فيتامين B8]]
* [[فيتامين B12]]

 {{ثبت المراجع}}
{{فيتامينات}}
{{مكملات غذائية}}
[[تصنيف:أدوية]]
[[تصنيف:موسوعة الأدوية]]
[[تصنيف:فيتامينات]]
[[تصنيف:مكملات غذائية]]