عرض مصدر إيدوكسيدين

{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 443802525
| IUPAC_name = 5-ethyl-1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione
| image = Edoxudin.svg
| alt =

<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 15176-29-1
| ATCvet =
| ATC_prefix = D06
| ATC_suffix = BB09
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 15ZQM81Y3R
|  PubChem = 66377
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 318153
|  ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 59752
|  smiles = O=C/1NC(=O)N(\C=C\1CC)[C@@H]2O[C@@H]([C@@H](O)C2)CO
|  StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C11H16N2O5/c1-2-6-4-13(11(17)12-10(6)16)9-3-7(15)8(5-14)18-9/h4,7-9,14-15H,2-3,5H2,1H3,(H,12,16,17)/t7-,8+,9+/m0/s1
|  StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = XACKNLSZYYIACO-DJLDLDEBSA-N

<!--Chemical data-->
| C = 11 | H = 16 | N = 2 | O = 5
| molecular_weight = 256.25514
}}

هو دواء مضاد للفيروسات. وهو مناظر لل[[ثيميدين]]، ال[[نوكليوزيد]]. وقد أظهر فعالية ضد فيروس الهربس البسيط.

==الاصطناع==

[[File:Edoxudine synthesis.png|700px|center|thumb|Edoxudine synthesis:<ref>K. K. Gauri, GB 1170565; eidem, {{US patent|3553192}} (1968, 1971 both to Robugen).</ref> Synthesis via organopalladium intermediates:<ref>{{Cite journal|doi=10.1021/ja00422a056|pmid=1249369|title=Synthesis of C-5 substituted pyrimidine nucleosides via organopalladium intermediates|year=1976|last1=Bergstrom|first1=Donald E.|last2=Ruth|first2=Jerry L.|journal=Journal of the American Chemical Society|volume=98|issue=6|pages=1587–9}}</ref><ref name="BergstromOgawa1978">{{cite journal|last1=Bergstrom|first1=Donald E.|last2=Ogawa|first2=Mark K.|title=C-5 substituted pyrimidine nucleosides. 2. Synthesis via olefin coupling to organopalladium intermediates derived from uridine and 2'-deoxyuridine|journal=Journal of the American Chemical Society|volume=100|issue=26|year=1978|pages=8106–8112|issn=0002-7863|doi=10.1021/ja00494a014}}</ref>]]


{{Antibiotics and chemotherapeutics for dermatological use}}
{{DNA antivirals}}

[[Category:Pyrimidinediones]]


{{antiinfective-drug-stub}}
{{dermatologic-drug-stub}}