عرض مصدر إلوبروست

{{Drugbox
| English = Iloprost
| verifiedrevid = 443868674
| IUPAC_name = 5-{(''E'')-(1''S'',5''S'',6''R'',7''R'')-7-hydroxy-6[(''E'')-(3''S'', 4''RS'')-3-hydroxy-4-methyl-1-octen-6-inyl]-bi-cyclo[3.3.0]octan-3-ylidene}pentanoic acid
| image = iloprost structure.png

<!--Clinical data-->
| tradename = Ventavis
| Drugs.com = {{drugs.com|monograph|iloprost}}
| licence_EU = Ventavis (inhalation) or Ilomedine (intravenous)
| licence_US = Iloprost
| pregnancy_category = C
| legal_status = Rx-only
| routes_of_administration = [[Nebulizer|Inhaled]] [[Intravenous]]

<!--Pharmacokinetic data-->
| bioavailability = The absolute bioavailability of inhaled iloprost has not been determined.
| metabolism = Iloprost is metabolized principally via &beta;-oxidation of the carboxyl [[side chain]]. The main metabolite is tetranor-iloprost, which is found in the urine in free and conjugated form. In animal experiments, tetranor-iloprost was pharmacologically inactive.
| elimination_half-life = 20–30 minutes
| excretion = ?

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number = 78919-13-8
| CAS_supplemental = {{CAS|73873-87-7}}
| ATC_prefix = B01
| ATC_suffix = AC11
| PubChem = 6435378
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01088
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4940161
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = JED5K35YGL
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02721
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 236025

<!--Chemical data-->
| C=22 | H=32 | O=4 
| molecular_weight = 360.48 g/mol
| smiles = O=C(O)CCC/C=C1/C[C@@H]2C(/C=C/[C@@H](O)C(C)CC#CC)[C@H](O)C[C@@H]2C1
| InChI = 1/C22H32O4/c1-3-4-7-15(2)20(23)11-10-18-19-13-16(8-5-6-9-22(25)26)12-17(19)14-21(18)24/h8,10-11,15,17-21,23-24H,5-7,9,12-14H2,1-2H3,(H,25,26)/b11-10+,16-8+/t15?,17-,18?,19-,20+,21+/m0/s1
| InChIKey = HIFJCPQKFCZDDL-SGSAMSKHBK
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H32O4/c1-3-4-7-15(2)20(23)11-10-18-19-13-16(8-5-6-9-22(25)26)12-17(19)14-21(18)24/h8,10-11,15,17-21,23-24H,5-7,9,12-14H2,1-2H3,(H,25,26)/b11-10+,16-8+/t15?,17-,18?,19-,20+,21+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HIFJCPQKFCZDDL-SGSAMSKHSA-N
}}
'''إيوبروست (Iloprost)''' تركيبه الكيميائي إلوبروست  تروميثامين، [[موسع وعائي]].
==الاستطباب==
يستخدم [[خافض ضغط|لعلاج ارتفاع التوتر الشرياني]] المتوسط إلى الشديد البدئي أو الثانوي.

==الجرعة==
'''البالغين''': يعطى تسريباً وريدياً بمعدل 0.5-2 نانو غرام/كلغ/دقيقة لمدة 6 ساعات يومياً.

يُحضر على شكل '''محلول معد '''للتسريب الوريدي''' بتركيز 67 مكغ/0.5مل.


{{أدوية ارتفاع ضغط دم الشريان التنفسي}}
[[تصنيف:أدوية]]
[[تصنيف:موسوعة الأدوية]]
[[تصنيف:خافضات ضغط الدم]]
[[تصنيف:أدوية ارتفاع ضغط دم الشريان التنفسي]]